C21H35N3O2 — CID 95872723
3-(3-hydroxy-3-methylbutyl)-N-[(3R)-3-(4-methylpiperazin-1-yl)butyl]benzamide (PubChem CID 95872723) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-(3-hydroxy-3-methylbutyl)-N-[(3R)-3-(4-methylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 3-(3-hydroxy-3-methylbutyl)-N-[(3R)-3-(4-methylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 95872723 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 3-(3-hydroxy-3-methylbutyl)-N-[(3R)-3-(4-methylpiperazin-1-yl)butyl]benzamide |
| SMILES | C[C@H](CCNC(=O)c1cccc(CCC(C)(C)O)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H35N3O2/c1-17(24-14-12-23(4)13-15-24)9-11-22-20(25)19-7-5-6-18(16-19)8-10-21(2,3)26/h5-7,16-17,26H,8-15H2,1-4H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | ZGEGGALCEMEDCN-QGZVFWFLSA-N |
| XLogP | 2.15 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |