C20H32N2O2 — CID 95896352
3-(3-hydroxy-3-methylbutyl)-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]benzamide (PubChem CID 95896352) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 3-(3-hydroxy-3-methylbutyl)-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]benzamide.
| Compound Name | 3-(3-hydroxy-3-methylbutyl)-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 95896352 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 3-(3-hydroxy-3-methylbutyl)-N-[2-[(2R)-2-methylpiperidin-1-yl]ethyl]benzamide |
| SMILES | C[C@@H]1CCCCN1CCNC(=O)c1cccc(CCC(C)(C)O)c1 |
| InChI | InChI=1S/C20H32N2O2/c1-16-7-4-5-13-22(16)14-12-21-19(23)18-9-6-8-17(15-18)10-11-20(2,3)24/h6,8-9,15-16,24H,4-5,7,10-14H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | QCVMSQQRVVKMEJ-MRXNPFEDSA-N |
| XLogP | 2.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |