C23H25FN6O — CID 170746019
(E)-3-amino-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide (PubChem CID 170746019) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is (E)-3-amino-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-3-amino-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 170746019 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (E)-3-amino-N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(/C=N/Cc2ccc(C(C)(C)C#N)cc2)=C/N)cc1F |
| InChI | InChI=1S/C23H25FN6O/c1-23(2,14-26)18-6-3-15(4-7-18)11-29-13-17(10-25)22(31)30-12-16-5-8-19(21(27)28)20(24)9-16/h3-10,13H,11-12,25H2,1-2H3,(H3,27,28)(H,30,31)/b17-10+,29-13+ |
| InChIKey | GUXBNZRHAUKTNE-FTZDRXBFSA-N |
| XLogP | 2.64 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|