C23H27N5O — CID 170746053
(E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[(4-prop-2-enylphenyl)methyliminomethyl]prop-2-enamide (PubChem CID 170746053) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is (E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[(4-prop-2-enylphenyl)methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[(4-prop-2-enylphenyl)methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 170746053 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[(4-prop-2-enylphenyl)methyliminomethyl]prop-2-enamide |
| SMILES | C=CCc1ccc(C/N=C/C(=C\N)C(=O)NCc2ccc(/C(N)=N/C)cc2)cc1 |
| InChI | InChI=1S/C23H27N5O/c1-3-4-17-5-7-18(8-6-17)14-27-16-21(13-24)23(29)28-15-19-9-11-20(12-10-19)22(25)26-2/h3,5-13,16H,1,4,14-15,24H2,2H3,(H2,25,26)(H,28,29)/b21-13+,27-16+ |
| InChIKey | WKKHPKQTDHTAQP-OXSJMEIESA-N |
| XLogP | 2.48 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|