C34H45N5O — CID 170746032
(E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[[4-(2-methylprop-2-enyl)phenyl]methyliminomethyl]prop-2-enamide;propane;toluene (PubChem CID 170746032) has the molecular formula C34H45N5O and a molecular weight of 539.77 g/mol. Its IUPAC name is (E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[[4-(2-methylprop-2-enyl)phenyl]methyliminomethyl]prop-2-enamide;propane;toluene.
| Compound Name | (E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[[4-(2-methylprop-2-enyl)phenyl]methyliminomethyl]prop-2-enamide;propane;toluene |
|---|---|
| PubChem CID | 170746032 |
| Molecular Formula | C34H45N5O |
| Molecular Weight | 539.77 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | (E)-3-amino-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]-2-[[4-(2-methylprop-2-enyl)phenyl]methyliminomethyl]prop-2-enamide;propane;toluene |
| SMILES | C=C(C)Cc1ccc(C/N=C/C(=C\N)C(=O)NCc2ccc(/C(N)=N/C)cc2)cc1.CCC.Cc1ccccc1 |
| InChI | InChI=1S/C24H29N5O.C7H8.C3H8/c1-17(2)12-18-4-6-19(7-5-18)14-28-16-22(13-25)24(30)29-15-20-8-10-21(11-9-20)23(26)27-3;1-7-5-3-2-4-6-7;1-3-2/h4-11,13,16H,1,12,14-15,25H2,2-3H3,(H2,26,27)(H,29,30);2-6H,1H3;3H2,1-2H3/b22-13+,28-16+;; |
| InChIKey | UMJXKZOUAHDMMO-JMVFKHHPSA-N |
| XLogP | 6.28 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.77 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|