C22H19Cl2N3O — CID 144564216
2-(3,4-dichlorophenyl)-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]benzamide (PubChem CID 144564216) has the molecular formula C22H19Cl2N3O and a molecular weight of 412.32 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]benzamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 144564216 |
| Molecular Formula | C22H19Cl2N3O |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[[4-(N'-methylcarbamimidoyl)phenyl]methyl]benzamide |
| SMILES | C/N=C(\N)c1ccc(CNC(=O)c2ccccc2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O/c1-26-21(25)15-8-6-14(7-9-15)13-27-22(28)18-5-3-2-4-17(18)16-10-11-19(23)20(24)12-16/h2-12H,13H2,1H3,(H2,25,26)(H,27,28) |
| InChIKey | AGFGNMGYCNTZNT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|