C22H21N7O — CID 170746018
(E)-3-amino-N-[(4-carbamimidoylphenyl)methyl]-2-[[4-(dicyanomethyl)phenyl]methyliminomethyl]prop-2-enamide (PubChem CID 170746018) has the molecular formula C22H21N7O and a molecular weight of 399.46 g/mol. Its IUPAC name is (E)-3-amino-N-[(4-carbamimidoylphenyl)methyl]-2-[[4-(dicyanomethyl)phenyl]methyliminomethyl]prop-2-enamide.
| Compound Name | (E)-3-amino-N-[(4-carbamimidoylphenyl)methyl]-2-[[4-(dicyanomethyl)phenyl]methyliminomethyl]prop-2-enamide |
|---|---|
| PubChem CID | 170746018 |
| Molecular Formula | C22H21N7O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (E)-3-amino-N-[(4-carbamimidoylphenyl)methyl]-2-[[4-(dicyanomethyl)phenyl]methyliminomethyl]prop-2-enamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(/C=N/Cc2ccc(C(C#N)C#N)cc2)=C/N)cc1 |
| InChI | InChI=1S/C22H21N7O/c23-9-19(10-24)17-5-1-15(2-6-17)12-28-14-20(11-25)22(30)29-13-16-3-7-18(8-4-16)21(26)27/h1-8,11,14,19H,12-13,25H2,(H3,26,27)(H,29,30)/b20-11+,28-14+ |
| InChIKey | WVBRVGYLRZYBLY-UVPVUANZSA-N |
| XLogP | 1.83 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|