C19H27FN6O4 — CID 123267961
2-[(2-acetamidoacetyl)amino]-N-[2-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-2-oxoethyl]-3-methylbutanamide (PubChem CID 123267961) has the molecular formula C19H27FN6O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-[(2-acetamidoacetyl)amino]-N-[2-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-2-oxoethyl]-3-methylbutanamide.
| Compound Name | 2-[(2-acetamidoacetyl)amino]-N-[2-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 123267961 |
| Molecular Formula | C19H27FN6O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[(2-acetamidoacetyl)amino]-N-[2-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-2-oxoethyl]-3-methylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)CNC(=O)C(NC(=O)CNC(C)=O)C(C)C)cc1F |
| InChI | InChI=1S/C19H27FN6O4/c1-10(2)17(26-16(29)9-23-11(3)27)19(30)25-8-15(28)24-7-12-4-5-13(18(21)22)14(20)6-12/h4-6,10,17H,7-9H2,1-3H3,(H3,21,22)(H,23,27)(H,24,28)(H,25,30)(H,26,29) |
| InChIKey | HNTWEIDHJNPBAE-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|