About hydrogen sulfite;octylcyclobutane
hydrogen sulfite;octylcyclobutane (PubChem CID 146190362) has the molecular formula C12H25O3S-
and a molecular weight of 249.40 g/mol. Its IUPAC name is hydrogen sulfite;octylcyclobutane.
Molecular Properties
| Compound Name | hydrogen sulfite;octylcyclobutane |
| PubChem CID | 146190362 |
| Molecular Formula | C12H25O3S- |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | hydrogen sulfite;octylcyclobutane |
| SMILES | CCCCCCCCC1CCC1.O=S([O-])O |
| InChI | InChI=1S/C12H24.H2O3S/c1-2-3-4-5-6-7-9-12-10-8-11-12;1-4(2)3/h12H,2-11H2,1H3;(H2,1,2,3)/p-1 |
| InChIKey | FLKOPFKSUKSBQU-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;octylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;octylcyclobutane?
The IUPAC name of hydrogen sulfite;octylcyclobutane (CID 146190362) is hydrogen sulfite;octylcyclobutane.
What is the SMILES notation for hydrogen sulfite;octylcyclobutane?
The canonical SMILES for hydrogen sulfite;octylcyclobutane is CCCCCCCCC1CCC1.O=S([O-])O.
What is the InChIKey of hydrogen sulfite;octylcyclobutane?
The InChIKey is FLKOPFKSUKSBQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H24.H2O3S/c1-2-3-4-5-6-7-9-12-10-8-11-12;1-4(2)3/h12H,2-11H2,1H3;(H2,1,2,3)/p-1.
What are the key properties of hydrogen sulfite;octylcyclobutane?
hydrogen sulfite;octylcyclobutane has a molecular weight of 249.40 g/mol, XLogP of 3.88, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;octylcyclobutane is sourced from PubChem (CID 146190362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).