C14H20ClNO3 — CID 146193835
(2R)-2-[3-chloro-4-(1,4-oxazepan-3-yl)phenoxy]propan-1-ol (PubChem CID 146193835) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is (2R)-2-[3-chloro-4-(1,4-oxazepan-3-yl)phenoxy]propan-1-ol.
| Compound Name | (2R)-2-[3-chloro-4-(1,4-oxazepan-3-yl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 146193835 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2R)-2-[3-chloro-4-(1,4-oxazepan-3-yl)phenoxy]propan-1-ol |
| SMILES | C[C@H](CO)Oc1ccc(C2COCCCN2)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO3/c1-10(8-17)19-11-3-4-12(13(15)7-11)14-9-18-6-2-5-16-14/h3-4,7,10,14,16-17H,2,5-6,8-9H2,1H3/t10-,14?/m1/s1 |
| InChIKey | BFGFEJZCHVDRAA-IAPIXIRKSA-N |
| XLogP | 2.15 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |