C13H16BrF2N3O3 — CID 146197060
5-bromo-2-[3-(2,2-difluoropiperidin-1-yl)propoxy]-3-nitropyridine (PubChem CID 146197060) has the molecular formula C13H16BrF2N3O3 and a molecular weight of 380.19 g/mol. Its IUPAC name is 5-bromo-2-[3-(2,2-difluoropiperidin-1-yl)propoxy]-3-nitropyridine.
| Compound Name | 5-bromo-2-[3-(2,2-difluoropiperidin-1-yl)propoxy]-3-nitropyridine |
|---|---|
| PubChem CID | 146197060 |
| Molecular Formula | C13H16BrF2N3O3 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 5-bromo-2-[3-(2,2-difluoropiperidin-1-yl)propoxy]-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1OCCCN1CCCCC1(F)F |
| InChI | InChI=1S/C13H16BrF2N3O3/c14-10-8-11(19(20)21)12(17-9-10)22-7-3-6-18-5-2-1-4-13(18,15)16/h8-9H,1-7H2 |
| InChIKey | BHCQHFSJLMIRDQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|