C14H17FN2O — CID 146198128
(2S)-2-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-(4-fluorophenyl)propanamide (PubChem CID 146198128) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is (2S)-2-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-(4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 146198128 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (2S)-2-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-(4-fluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1)C12CC(N)(C1)C2 |
| InChI | InChI=1S/C14H17FN2O/c1-9(13-6-14(16,7-13)8-13)12(18)17-11-4-2-10(15)3-5-11/h2-5,9H,6-8,16H2,1H3,(H,17,18)/t9-,13?,14?/m1/s1 |
| InChIKey | HVZVGISEAHGMEY-BZFQTPOWSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |