C20H19ClFN3O2 — CID 146198181
6-chloro-N-[3-[1-(4-fluoroanilino)-1-oxopropan-2-yl]-1-bicyclo[1.1.1]pentanyl]pyridine-2-carboxamide (PubChem CID 146198181) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is 6-chloro-N-[3-[1-(4-fluoroanilino)-1-oxopropan-2-yl]-1-bicyclo[1.1.1]pentanyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[3-[1-(4-fluoroanilino)-1-oxopropan-2-yl]-1-bicyclo[1.1.1]pentanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146198181 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 6-chloro-N-[3-[1-(4-fluoroanilino)-1-oxopropan-2-yl]-1-bicyclo[1.1.1]pentanyl]pyridine-2-carboxamide |
| SMILES | CC(C(=O)Nc1ccc(F)cc1)C12CC(NC(=O)c3cccc(Cl)n3)(C1)C2 |
| InChI | InChI=1S/C20H19ClFN3O2/c1-12(17(26)23-14-7-5-13(22)6-8-14)19-9-20(10-19,11-19)25-18(27)15-3-2-4-16(21)24-15/h2-8,12H,9-11H2,1H3,(H,23,26)(H,25,27) |
| InChIKey | MQCDRDZKKHQOAK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|