C19H19ClFN3O2 — CID 166896841
6-chloro-N-[(4S)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]pyridine-2-carboxamide (PubChem CID 166896841) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is 6-chloro-N-[(4S)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[(4S)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166896841 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 6-chloro-N-[(4S)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]pyridine-2-carboxamide |
| SMILES | C=C(CCNC(=O)c1cccc(Cl)n1)[C@H](C)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19ClFN3O2/c1-12(10-11-22-19(26)16-4-3-5-17(20)24-16)13(2)18(25)23-15-8-6-14(21)7-9-15/h3-9,13H,1,10-11H2,2H3,(H,22,26)(H,23,25)/t13-/m0/s1 |
| InChIKey | WEWYBOXSVGQDMD-ZDUSSCGKSA-N |
| XLogP | 3.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|