C20H19F3N2O2 — CID 166896733
3,4-difluoro-N-[(4R)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]benzamide (PubChem CID 166896733) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 3,4-difluoro-N-[(4R)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]benzamide.
| Compound Name | 3,4-difluoro-N-[(4R)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 166896733 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3,4-difluoro-N-[(4R)-5-(4-fluoroanilino)-4-methyl-3-methylidene-5-oxopentyl]benzamide |
| SMILES | C=C(CCNC(=O)c1ccc(F)c(F)c1)[C@@H](C)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F3N2O2/c1-12(13(2)19(26)25-16-6-4-15(21)5-7-16)9-10-24-20(27)14-3-8-17(22)18(23)11-14/h3-8,11,13H,1,9-10H2,2H3,(H,24,27)(H,25,26)/t13-/m1/s1 |
| InChIKey | CFBROXKRBZXLMA-CYBMUJFWSA-N |
| XLogP | 4.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|