C19H17ClF2N2O2 — CID 166896887
3-chloro-4-fluoro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]benzamide (PubChem CID 166896887) has the molecular formula C19H17ClF2N2O2 and a molecular weight of 378.81 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]benzamide.
| Compound Name | 3-chloro-4-fluoro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 166896887 |
| Molecular Formula | C19H17ClF2N2O2 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-chloro-4-fluoro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]benzamide |
| SMILES | C=C(CCNC(=O)c1ccc(F)c(Cl)c1)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17ClF2N2O2/c1-12(10-18(25)24-15-5-3-14(21)4-6-15)8-9-23-19(26)13-2-7-17(22)16(20)11-13/h2-7,11H,1,8-10H2,(H,23,26)(H,24,25) |
| InChIKey | VYKJVJZODBJZEZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|