C18H17ClFN3O2 — CID 166896854
6-chloro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]pyridine-3-carboxamide (PubChem CID 166896854) has the molecular formula C18H17ClFN3O2 and a molecular weight of 361.80 g/mol. Its IUPAC name is 6-chloro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166896854 |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 6-chloro-N-[5-(4-fluoroanilino)-3-methylidene-5-oxopentyl]pyridine-3-carboxamide |
| SMILES | C=C(CCNC(=O)c1ccc(Cl)nc1)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17ClFN3O2/c1-12(10-17(24)23-15-5-3-14(20)4-6-15)8-9-21-18(25)13-2-7-16(19)22-11-13/h2-7,11H,1,8-10H2,(H,21,25)(H,23,24) |
| InChIKey | DSSOKXJACQJFIC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|