C18H20N2O3 — CID 146198712
(1H-indole-7-carbonylamino) 2-methylspiro[3.3]heptane-2-carboxylate (PubChem CID 146198712) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (1H-indole-7-carbonylamino) 2-methylspiro[3.3]heptane-2-carboxylate.
| Compound Name | (1H-indole-7-carbonylamino) 2-methylspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 146198712 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (1H-indole-7-carbonylamino) 2-methylspiro[3.3]heptane-2-carboxylate |
| SMILES | CC1(C(=O)ONC(=O)c2cccc3cc[nH]c23)CC2(CCC2)C1 |
| InChI | InChI=1S/C18H20N2O3/c1-17(10-18(11-17)7-3-8-18)16(22)23-20-15(21)13-5-2-4-12-6-9-19-14(12)13/h2,4-6,9,19H,3,7-8,10-11H2,1H3,(H,20,21) |
| InChIKey | JGVWHFGSZJXQDO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|