C32H48N4O2S — CID 146199079
[4-(3a-cyclononyl-3,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-6-yl)phenyl]-[4-(1-aminocyclobutanecarbonyl)piperazin-1-yl]methanone (PubChem CID 146199079) has the molecular formula C32H48N4O2S and a molecular weight of 552.83 g/mol. Its IUPAC name is [4-(3a-cyclononyl-3,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-6-yl)phenyl]-[4-(1-aminocyclobutanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(3a-cyclononyl-3,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-6-yl)phenyl]-[4-(1-aminocyclobutanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 146199079 |
| Molecular Formula | C32H48N4O2S |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | [4-(3a-cyclononyl-3,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-6-yl)phenyl]-[4-(1-aminocyclobutanecarbonyl)piperazin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCN(C(=O)c3ccc(C4CCC5(C6CCCCCCCC6)NCSC5C4)cc3)CC2)CCC1 |
| InChI | InChI=1S/C32H48N4O2S/c33-31(15-7-16-31)30(38)36-20-18-35(19-21-36)29(37)25-12-10-24(11-13-25)26-14-17-32(28(22-26)39-23-34-32)27-8-5-3-1-2-4-6-9-27/h10-13,26-28,34H,1-9,14-23,33H2 |
| InChIKey | MPGWDZMROSKOIJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |