C30H45N5O2 — CID 146199134
[4-(3a-cycloheptyl-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indazol-6-yl)phenyl]-[4-(1-aminocyclopropanecarbonyl)piperazin-1-yl]methanone (PubChem CID 146199134) has the molecular formula C30H45N5O2 and a molecular weight of 507.72 g/mol. Its IUPAC name is [4-(3a-cycloheptyl-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indazol-6-yl)phenyl]-[4-(1-aminocyclopropanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(3a-cycloheptyl-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indazol-6-yl)phenyl]-[4-(1-aminocyclopropanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 146199134 |
| Molecular Formula | C30H45N5O2 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.36 |
| IUPAC Name | [4-(3a-cycloheptyl-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indazol-6-yl)phenyl]-[4-(1-aminocyclopropanecarbonyl)piperazin-1-yl]methanone |
| SMILES | CN1NCC2(C3CCCCCC3)CCC(c3ccc(C(=O)N4CCN(C(=O)C5(N)CC5)CC4)cc3)CC12 |
| InChI | InChI=1S/C30H45N5O2/c1-33-26-20-24(12-13-29(26,21-32-33)25-6-4-2-3-5-7-25)22-8-10-23(11-9-22)27(36)34-16-18-35(19-17-34)28(37)30(31)14-15-30/h8-11,24-26,32H,2-7,12-21,31H2,1H3 |
| InChIKey | IFRXROCKCMUPKB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |