C23H28N2O3 — CID 146200094
[7-[(4-tert-butylbenzoyl)amino]-2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl] acetate (PubChem CID 146200094) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [7-[(4-tert-butylbenzoyl)amino]-2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl] acetate.
| Compound Name | [7-[(4-tert-butylbenzoyl)amino]-2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl] acetate |
|---|---|
| PubChem CID | 146200094 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [7-[(4-tert-butylbenzoyl)amino]-2,3,4,5-tetrahydro-1H-1-benzazepin-8-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1NC(=O)c1ccc(C(C)(C)C)cc1)CCCCN2 |
| InChI | InChI=1S/C23H28N2O3/c1-15(26)28-21-14-19-17(7-5-6-12-24-19)13-20(21)25-22(27)16-8-10-18(11-9-16)23(2,3)4/h8-11,13-14,24H,5-7,12H2,1-4H3,(H,25,27) |
| InChIKey | DXTBGDYDKLSSLV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|