C25H29Cl2FN2O — CID 146200735
3-(3-chloro-2-fluorophenyl)-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-8,8-dimethyl-1-azaspiro[4.5]decane-4-carboxamide (PubChem CID 146200735) has the molecular formula C25H29Cl2FN2O and a molecular weight of 463.42 g/mol. Its IUPAC name is 3-(3-chloro-2-fluorophenyl)-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-8,8-dimethyl-1-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | 3-(3-chloro-2-fluorophenyl)-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-8,8-dimethyl-1-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 146200735 |
| Molecular Formula | C25H29Cl2FN2O |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-(3-chloro-2-fluorophenyl)-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-8,8-dimethyl-1-azaspiro[4.5]decane-4-carboxamide |
| SMILES | C#C/C=C\C(Cl)=C/CNC(=O)C1C(c2cccc(Cl)c2F)CNC12CCC(C)(C)CC2 |
| InChI | InChI=1S/C25H29Cl2FN2O/c1-4-5-7-17(26)10-15-29-23(31)21-19(18-8-6-9-20(27)22(18)28)16-30-25(21)13-11-24(2,3)12-14-25/h1,5-10,19,21,30H,11-16H2,2-3H3,(H,29,31)/b7-5-,17-10+ |
| InChIKey | ZJWDQZBDTQTOFO-HXUVOAHHSA-N |
| XLogP | 5.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|