C31H32Cl2FN3O3 — CID 168946200
1-[[(2R)-3-(3-chloro-2-fluorophenyl)-1-(4-formylanilino)-1-oxobutan-2-yl]amino]-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]cyclohexane-1-carboxamide (PubChem CID 168946200) has the molecular formula C31H32Cl2FN3O3 and a molecular weight of 584.52 g/mol. Its IUPAC name is 1-[[(2R)-3-(3-chloro-2-fluorophenyl)-1-(4-formylanilino)-1-oxobutan-2-yl]amino]-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]cyclohexane-1-carboxamide.
| Compound Name | 1-[[(2R)-3-(3-chloro-2-fluorophenyl)-1-(4-formylanilino)-1-oxobutan-2-yl]amino]-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 168946200 |
| Molecular Formula | C31H32Cl2FN3O3 |
| Molecular Weight | 584.52 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 1-[[(2R)-3-(3-chloro-2-fluorophenyl)-1-(4-formylanilino)-1-oxobutan-2-yl]amino]-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]cyclohexane-1-carboxamide |
| SMILES | C#C/C=C\C(Cl)=C/CNC(=O)C1(N[C@@H](C(=O)Nc2ccc(C=O)cc2)C(C)c2cccc(Cl)c2F)CCCCC1 |
| InChI | InChI=1S/C31H32Cl2FN3O3/c1-3-4-9-23(32)16-19-35-30(40)31(17-6-5-7-18-31)37-28(21(2)25-10-8-11-26(33)27(25)34)29(39)36-24-14-12-22(20-38)13-15-24/h1,4,8-16,20-21,28,37H,5-7,17-19H2,2H3,(H,35,40)(H,36,39)/b9-4-,23-16+/t21?,28-/m1/s1 |
| InChIKey | XBHKKFPMPTUXSB-WRVDAHARSA-N |
| XLogP | 6.12 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|