C15H29O2P — CID 146200737
cyclopentyl-[1-(5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-methylphosphane (PubChem CID 146200737) has the molecular formula C15H29O2P and a molecular weight of 272.37 g/mol. Its IUPAC name is cyclopentyl-[1-(5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-methylphosphane.
| Compound Name | cyclopentyl-[1-(5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-methylphosphane |
|---|---|
| PubChem CID | 146200737 |
| Molecular Formula | C15H29O2P |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | cyclopentyl-[1-(5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-methylphosphane |
| SMILES | CCC1OC(C)(C)OC1C(C)P(C)C1CCCC1 |
| InChI | InChI=1S/C15H29O2P/c1-6-13-14(17-15(3,4)16-13)11(2)18(5)12-9-7-8-10-12/h11-14H,6-10H2,1-5H3 |
| InChIKey | CEAJAZYFBSTKMM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|