C23H27N7O2S — CID 146201893
[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl] N-ethanimidoyl-N-propan-2-ylcarbamimidothioate (PubChem CID 146201893) has the molecular formula C23H27N7O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is [7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl] N-ethanimidoyl-N-propan-2-ylcarbamimidothioate.
| Compound Name | [7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl] N-ethanimidoyl-N-propan-2-ylcarbamimidothioate |
|---|---|
| PubChem CID | 146201893 |
| Molecular Formula | C23H27N7O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl] N-ethanimidoyl-N-propan-2-ylcarbamimidothioate |
| SMILES | [H]/N=C(\C)N(/C(=N\[H])Sc1nc(C)nc2[nH]c3cc(-c4c(C)noc4C)c(OC)cc3c12)C(C)C |
| InChI | InChI=1S/C23H27N7O2S/c1-10(2)30(13(5)24)23(25)33-22-20-15-9-18(31-7)16(19-11(3)29-32-12(19)4)8-17(15)28-21(20)26-14(6)27-22/h8-10,24-25H,1-7H3,(H,26,27,28)/b24-13+,25-23+ |
| InChIKey | SWNYEJATVQBXFL-OBYGDSCDSA-N |
| XLogP | 5.43 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|