C16H16F4N4O2 — CID 146202071
ethyl N-[2-amino-3-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]phenyl]carbamate (PubChem CID 146202071) has the molecular formula C16H16F4N4O2 and a molecular weight of 372.32 g/mol. Its IUPAC name is ethyl N-[2-amino-3-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-3-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 146202071 |
| Molecular Formula | C16H16F4N4O2 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | ethyl N-[2-amino-3-fluoro-4-[[6-(trifluoromethyl)-3-pyridinyl]methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(C(F)(F)F)nc2)c(F)c1N |
| InChI | InChI=1S/C16H16F4N4O2/c1-2-26-15(25)24-11-5-4-10(13(17)14(11)21)22-7-9-3-6-12(23-8-9)16(18,19)20/h3-6,8,22H,2,7,21H2,1H3,(H,24,25) |
| InChIKey | QGMYAHJROPECLZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|