C12H14F4N2O2 — CID 136548083
3-fluoropropyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]carbamate (PubChem CID 136548083) has the molecular formula C12H14F4N2O2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-fluoropropyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]carbamate.
| Compound Name | 3-fluoropropyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]carbamate |
|---|---|
| PubChem CID | 136548083 |
| Molecular Formula | C12H14F4N2O2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-fluoropropyl N-[2-[5-(trifluoromethyl)-2-pyridinyl]ethyl]carbamate |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cn1)OCCCF |
| InChI | InChI=1S/C12H14F4N2O2/c13-5-1-7-20-11(19)17-6-4-10-3-2-9(8-18-10)12(14,15)16/h2-3,8H,1,4-7H2,(H,17,19) |
| InChIKey | NZQVLSFZIPSZBE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|