C25H25FN6O2 — CID 146203424
4-[[(4,5-dimethyl-6-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-2-yl)amino]methyl]-N-(4-fluorophenyl)benzamide (PubChem CID 146203424) has the molecular formula C25H25FN6O2 and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-[[(4,5-dimethyl-6-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-2-yl)amino]methyl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-[[(4,5-dimethyl-6-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-2-yl)amino]methyl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 146203424 |
| Molecular Formula | C25H25FN6O2 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-[[(4,5-dimethyl-6-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-2-yl)amino]methyl]-N-(4-fluorophenyl)benzamide |
| SMILES | Cc1nc(NCc2ccc(C(=O)Nc3ccc(F)cc3)cc2)nc2c1N(C)C(=O)C1CCCN21 |
| InChI | InChI=1S/C25H25FN6O2/c1-15-21-22(32-13-3-4-20(32)24(34)31(21)2)30-25(28-15)27-14-16-5-7-17(8-6-16)23(33)29-19-11-9-18(26)10-12-19/h5-12,20H,3-4,13-14H2,1-2H3,(H,29,33)(H,27,28,30) |
| InChIKey | HOCVRQWNTXNZTO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |