C23H26FN7O — CID 167339569
(6aR)-2-[[2-[(4-fluorophenyl)methyl]-2H-imidazol-4-yl]methylamino]-5-methyl-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one (PubChem CID 167339569) has the molecular formula C23H26FN7O and a molecular weight of 435.51 g/mol. Its IUPAC name is (6aR)-2-[[2-[(4-fluorophenyl)methyl]-2H-imidazol-4-yl]methylamino]-5-methyl-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one.
| Compound Name | (6aR)-2-[[2-[(4-fluorophenyl)methyl]-2H-imidazol-4-yl]methylamino]-5-methyl-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 167339569 |
| Molecular Formula | C23H26FN7O |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (6aR)-2-[[2-[(4-fluorophenyl)methyl]-2H-imidazol-4-yl]methylamino]-5-methyl-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one |
| SMILES | CN1C(=O)[C@H]2CCCCCN2c2nc(NCC3=NC(Cc4ccc(F)cc4)N=C3)ncc21 |
| InChI | InChI=1S/C23H26FN7O/c1-30-19-14-27-23(29-21(19)31-10-4-2-3-5-18(31)22(30)32)26-13-17-12-25-20(28-17)11-15-6-8-16(24)9-7-15/h6-9,12,14,18,20H,2-5,10-11,13H2,1H3,(H,26,27,29)/t18-,20?/m1/s1 |
| InChIKey | FAFXLKOCBMPIEZ-QSVWIEALSA-N |
| XLogP | 2.85 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |