C21H24N8O3S — CID 159740596
(6aS)-5-methyl-2-[[1-[(3-nitrophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane (PubChem CID 159740596) has the molecular formula C21H24N8O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is (6aS)-5-methyl-2-[[1-[(3-nitrophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane.
| Compound Name | (6aS)-5-methyl-2-[[1-[(3-nitrophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane |
|---|---|
| PubChem CID | 159740596 |
| Molecular Formula | C21H24N8O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (6aS)-5-methyl-2-[[1-[(3-nitrophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane |
| SMILES | CN1C(=O)[C@@H]2CCCN2c2nc(NCc3cnn(Cc4cccc([N+](=O)[O-])c4)c3)ncc21.S |
| InChI | InChI=1S/C21H22N8O3.H2S/c1-26-18-11-23-21(25-19(18)28-7-3-6-17(28)20(26)30)22-9-15-10-24-27(13-15)12-14-4-2-5-16(8-14)29(31)32;/h2,4-5,8,10-11,13,17H,3,6-7,9,12H2,1H3,(H,22,23,25);1H2/t17-;/m0./s1 |
| InChIKey | NCKGOLJUSJSDMV-LMOVPXPDSA-N |
| XLogP | 2.30 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|