C23H28FN7O2S — CID 158052174
(6aS)-2-[[1-[(4-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]methylamino]-4,5-dimethyl-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane (PubChem CID 158052174) has the molecular formula C23H28FN7O2S and a molecular weight of 485.59 g/mol. Its IUPAC name is (6aS)-2-[[1-[(4-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]methylamino]-4,5-dimethyl-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane.
| Compound Name | (6aS)-2-[[1-[(4-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]methylamino]-4,5-dimethyl-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane |
|---|---|
| PubChem CID | 158052174 |
| Molecular Formula | C23H28FN7O2S |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (6aS)-2-[[1-[(4-fluoro-3-methoxyphenyl)methyl]pyrazol-4-yl]methylamino]-4,5-dimethyl-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one;sulfane |
| SMILES | COc1cc(Cn2cc(CNc3nc(C)c4c(n3)N3CCC[C@H]3C(=O)N4C)cn2)ccc1F.S |
| InChI | InChI=1S/C23H26FN7O2.H2S/c1-14-20-21(31-8-4-5-18(31)22(32)29(20)2)28-23(27-14)25-10-16-11-26-30(13-16)12-15-6-7-17(24)19(9-15)33-3;/h6-7,9,11,13,18H,4-5,8,10,12H2,1-3H3,(H,25,27,28);1H2/t18-;/m0./s1 |
| InChIKey | FJPOXGPXRSVBAG-FERBBOLQSA-N |
| XLogP | 2.85 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |