C13H16NO4PS2 — CID 146204584
(3aS,7aS)-7a-methyl-2-(4-nitrophenoxy)-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole (PubChem CID 146204584) has the molecular formula C13H16NO4PS2 and a molecular weight of 345.38 g/mol. Its IUPAC name is (3aS,7aS)-7a-methyl-2-(4-nitrophenoxy)-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole.
| Compound Name | (3aS,7aS)-7a-methyl-2-(4-nitrophenoxy)-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole |
|---|---|
| PubChem CID | 146204584 |
| Molecular Formula | C13H16NO4PS2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (3aS,7aS)-7a-methyl-2-(4-nitrophenoxy)-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole |
| SMILES | C[C@]12CCCC[C@@H]1SP(=S)(Oc1ccc([N+](=O)[O-])cc1)O2 |
| InChI | InChI=1S/C13H16NO4PS2/c1-13-9-3-2-4-12(13)21-19(20,18-13)17-11-7-5-10(6-8-11)14(15)16/h5-8,12H,2-4,9H2,1H3/t12-,13-,19?/m0/s1 |
| InChIKey | UXHPEQKLEOJJAG-LOAJIVSNSA-N |
| XLogP | 4.66 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|