C25H25FN4O5 — CID 146205382
1-[(5S)-3-[2-(7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea (PubChem CID 146205382) has the molecular formula C25H25FN4O5 and a molecular weight of 480.50 g/mol. Its IUPAC name is 1-[(5S)-3-[2-(7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea.
| Compound Name | 1-[(5S)-3-[2-(7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
|---|---|
| PubChem CID | 146205382 |
| Molecular Formula | C25H25FN4O5 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-[(5S)-3-[2-(7-fluoro-1,3,4,5-tetrahydro-2-benzazepin-2-yl)-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@]21OC(=O)N(CC(=O)N2CCCc3cc(F)ccc3C2)C1=O |
| InChI | InChI=1S/C25H25FN4O5/c1-27-23(33)28-19-6-7-20-16(12-19)8-9-25(20)22(32)30(24(34)35-25)14-21(31)29-10-2-3-15-11-18(26)5-4-17(15)13-29/h4-7,11-12H,2-3,8-10,13-14H2,1H3,(H2,27,28,33)/t25-/m0/s1 |
| InChIKey | NQLKSOHNODZZNS-VWLOTQADSA-N |
| XLogP | 2.67 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |