C27H29FN4O5 — CID 146633775
1-[(5R)-3-[2-[5-(4-fluorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea (PubChem CID 146633775) has the molecular formula C27H29FN4O5 and a molecular weight of 508.55 g/mol. Its IUPAC name is 1-[(5R)-3-[2-[5-(4-fluorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea.
| Compound Name | 1-[(5R)-3-[2-[5-(4-fluorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
|---|---|
| PubChem CID | 146633775 |
| Molecular Formula | C27H29FN4O5 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1-[(5R)-3-[2-[5-(4-fluorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@@]21OC(=O)N(CC(=O)N2C(c3ccc(F)cc3)CCC2(C)C)C1=O |
| InChI | InChI=1S/C27H29FN4O5/c1-26(2)12-11-21(16-4-6-18(28)7-5-16)32(26)22(33)15-31-23(34)27(37-25(31)36)13-10-17-14-19(8-9-20(17)27)30-24(35)29-3/h4-9,14,21H,10-13,15H2,1-3H3,(H2,29,30,35)/t21?,27-/m1/s1 |
| InChIKey | QFLUXPYQAAGHQK-IAIRZMIISA-N |
| XLogP | 3.84 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |