C28H29FN4O5 — CID 164706866
1-cyclopropyl-3-[3-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]urea (PubChem CID 164706866) has the molecular formula C28H29FN4O5 and a molecular weight of 520.56 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]urea.
| Compound Name | 1-cyclopropyl-3-[3-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]urea |
|---|---|
| PubChem CID | 164706866 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 1-cyclopropyl-3-[3-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]urea |
| SMILES | C[C@H]1CC[C@@H](c2ccc(F)cc2)N1C(=O)CN1C(=O)OC2(CCc3cc(NC(=O)NC4CC4)ccc32)C1=O |
| InChI | InChI=1S/C28H29FN4O5/c1-16-2-11-23(17-3-5-19(29)6-4-17)33(16)24(34)15-32-25(35)28(38-27(32)37)13-12-18-14-21(9-10-22(18)28)31-26(36)30-20-7-8-20/h3-6,9-10,14,16,20,23H,2,7-8,11-13,15H2,1H3,(H2,30,31,36)/t16-,23-,28?/m0/s1 |
| InChIKey | GTOWJCKVJXTOJQ-WRRIYLEZSA-N |
| XLogP | 3.98 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |