C24H24FN3O4 — CID 167026304
6-amino-3'-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione (PubChem CID 167026304) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is 6-amino-3'-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione.
| Compound Name | 6-amino-3'-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 167026304 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 6-amino-3'-[2-[(2S,5S)-2-(4-fluorophenyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]spiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-2',4'-dione |
| SMILES | C[C@H]1CC[C@@H](c2ccc(F)cc2)N1C(=O)CN1C(=O)OC2(CCc3cc(N)ccc32)C1=O |
| InChI | InChI=1S/C24H24FN3O4/c1-14-2-9-20(15-3-5-17(25)6-4-15)28(14)21(29)13-27-22(30)24(32-23(27)31)11-10-16-12-18(26)7-8-19(16)24/h3-8,12,14,20H,2,9-11,13,26H2,1H3/t14-,20-,24?/m0/s1 |
| InChIKey | YSULMZCBMTUNMC-VTSLXLNKSA-N |
| XLogP | 3.28 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|