About CID 146633971
CID 146633971 (PubChem CID 146633971) has the molecular formula C28H29FN4O5
and a molecular weight of 520.56 g/mol.
Molecular Properties
| Compound Name | CID 146633971 |
| PubChem CID | 146633971 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | — |
| SMILES | CNC(=O)Nc1ccc2c(c1)C1(CC1)CC21OC(=O)N(CC(=O)N2[C@@H](C)CC[C@H]2c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C28H29FN4O5/c1-16-3-10-22(17-4-6-18(29)7-5-17)33(16)23(34)14-32-24(35)28(38-26(32)37)15-27(11-12-27)21-13-19(8-9-20(21)28)31-25(36)30-2/h4-9,13,16,22H,3,10-12,14-15H2,1-2H3,(H2,30,31,36)/t16-,22-,28?/m0/s1 |
| InChIKey | PMQVMZGQXNSTQV-JRWVNWIFSA-N |
| XLogP | 3.94 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 146633971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146633971?
The IUPAC name of CID 146633971 (CID 146633971) is not available.
What is the SMILES notation for CID 146633971?
The canonical SMILES for CID 146633971 is CNC(=O)Nc1ccc2c(c1)C1(CC1)CC21OC(=O)N(CC(=O)N2[C@@H](C)CC[C@H]2c2ccc(F)cc2)C1=O.
What is the InChIKey of CID 146633971?
The InChIKey is PMQVMZGQXNSTQV-JRWVNWIFSA-N. The full InChI is InChI=1S/C28H29FN4O5/c1-16-3-10-22(17-4-6-18(29)7-5-17)33(16)23(34)14-32-24(35)28(38-26(32)37)15-27(11-12-27)21-13-19(8-9-20(21)28)31-25(36)30-2/h4-9,13,16,22H,3,10-12,14-15H2,1-2H3,(H2,30,31,36)/t16-,22-,28?/m0/s1.
What are the key properties of CID 146633971?
CID 146633971 has a molecular weight of 520.56 g/mol, XLogP of 3.94, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146633971 is sourced from PubChem (CID 146633971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).