C28H29FN4O5 — CID 146633971
CID 146633971 (PubChem CID 146633971) has the molecular formula C28H29FN4O5 and a molecular weight of 520.56 g/mol.
| Compound Name | CID 146633971 |
|---|---|
| PubChem CID | 146633971 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | — |
| SMILES | CNC(=O)Nc1ccc2c(c1)C1(CC1)CC21OC(=O)N(CC(=O)N2[C@@H](C)CC[C@H]2c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C28H29FN4O5/c1-16-3-10-22(17-4-6-18(29)7-5-17)33(16)23(34)14-32-24(35)28(38-26(32)37)15-27(11-12-27)21-13-19(8-9-20(21)28)31-25(36)30-2/h4-9,13,16,22H,3,10-12,14-15H2,1-2H3,(H2,30,31,36)/t16-,22-,28?/m0/s1 |
| InChIKey | PMQVMZGQXNSTQV-JRWVNWIFSA-N |
| XLogP | 3.94 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |