C10H12BrNO2S — CID 146205442
2-bromo-1-[(3R)-3-methyl-3,5-dihydro-2H-thieno[3,2-f][1,4]oxazepin-4-yl]ethanone (PubChem CID 146205442) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-bromo-1-[(3R)-3-methyl-3,5-dihydro-2H-thieno[3,2-f][1,4]oxazepin-4-yl]ethanone.
| Compound Name | 2-bromo-1-[(3R)-3-methyl-3,5-dihydro-2H-thieno[3,2-f][1,4]oxazepin-4-yl]ethanone |
|---|---|
| PubChem CID | 146205442 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 2-bromo-1-[(3R)-3-methyl-3,5-dihydro-2H-thieno[3,2-f][1,4]oxazepin-4-yl]ethanone |
| SMILES | C[C@@H]1COc2sccc2CN1C(=O)CBr |
| InChI | InChI=1S/C10H12BrNO2S/c1-7-6-14-10-8(2-3-15-10)5-12(7)9(13)4-11/h2-3,7H,4-6H2,1H3/t7-/m1/s1 |
| InChIKey | NFBSJWMXZJXWKA-SSDOTTSWSA-N |
| XLogP | 2.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|