C16H19F4NO3 — CID 125138627
1-[(3S)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one (PubChem CID 125138627) has the molecular formula C16H19F4NO3 and a molecular weight of 349.32 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one.
| Compound Name | 1-[(3S)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
|---|---|
| PubChem CID | 125138627 |
| Molecular Formula | C16H19F4NO3 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-[(3S)-3-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
| SMILES | C[C@H]1COc2ccccc2CN1C(=O)CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C16H19F4NO3/c1-11-9-24-13-5-3-2-4-12(13)8-21(11)14(22)6-7-23-10-16(19,20)15(17)18/h2-5,11,15H,6-10H2,1H3/t11-/m0/s1 |
| InChIKey | YSAYDLUILHZISO-NSHDSACASA-N |
| XLogP | 3.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|