C16H19F4NO2 — CID 91662643
1-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one (PubChem CID 91662643) has the molecular formula C16H19F4NO2 and a molecular weight of 333.33 g/mol. Its IUPAC name is 1-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one.
| Compound Name | 1-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
|---|---|
| PubChem CID | 91662643 |
| Molecular Formula | C16H19F4NO2 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-(3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-1-one |
| SMILES | CC1Cc2ccccc2CN1C(=O)CCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C16H19F4NO2/c1-11-8-12-4-2-3-5-13(12)9-21(11)14(22)6-7-23-10-16(19,20)15(17)18/h2-5,11,15H,6-10H2,1H3 |
| InChIKey | NMZVFIWTFNBOIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|