C17H18N2O3S — CID 146205566
(E)-3-(3,4-dihydroxyphenyl)-2-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 146205566) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-2-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-2-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146205566 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-2-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | C/C(=C\c1ccc(O)c(O)c1)C(=O)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C17H18N2O3S/c1-10(8-11-6-7-13(20)14(21)9-11)16(22)19-17-18-12-4-2-3-5-15(12)23-17/h6-9,20-21H,2-5H2,1H3,(H,18,19,22)/b10-8+ |
| InChIKey | WUUBBQVBURIOJB-CSKARUKUSA-N |
| XLogP | 3.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|