C21H18N2OS — CID 6525557
(E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,3-diphenylprop-2-enamide (PubChem CID 6525557) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 6525557 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (E)-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1nc2c(s1)CCC2)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2OS/c24-20(23-21-22-18-12-7-13-19(18)25-21)17(16-10-5-2-6-11-16)14-15-8-3-1-4-9-15/h1-6,8-11,14H,7,12-13H2,(H,22,23,24)/b17-14+ |
| InChIKey | QUCNDLYDZVQJDA-SAPNQHFASA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|