C9H14N2 — CID 146206467
(5R)-5-methyl-1,2,5,6,7,8-hexahydroquinazoline (PubChem CID 146206467) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (5R)-5-methyl-1,2,5,6,7,8-hexahydroquinazoline.
| Compound Name | (5R)-5-methyl-1,2,5,6,7,8-hexahydroquinazoline |
|---|---|
| PubChem CID | 146206467 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (5R)-5-methyl-1,2,5,6,7,8-hexahydroquinazoline |
| SMILES | C[C@@H]1CCCC2=C1C=NCN2 |
| InChI | InChI=1S/C9H14N2/c1-7-3-2-4-9-8(7)5-10-6-11-9/h5,7,11H,2-4,6H2,1H3/t7-/m1/s1 |
| InChIKey | HTKXVVRGBCTHNM-SSDOTTSWSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |