C23H22F4N2O2 — CID 146206489
N-cyclohexyl-4-fluoro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-7-carboxamide (PubChem CID 146206489) has the molecular formula C23H22F4N2O2 and a molecular weight of 434.43 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-7-carboxamide.
| Compound Name | N-cyclohexyl-4-fluoro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-7-carboxamide |
|---|---|
| PubChem CID | 146206489 |
| Molecular Formula | C23H22F4N2O2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-cyclohexyl-4-fluoro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-7-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(F)c2ccn(Cc3ccc(OC(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C23H22F4N2O2/c24-20-11-10-19(22(30)28-16-4-2-1-3-5-16)21-18(20)12-13-29(21)14-15-6-8-17(9-7-15)31-23(25,26)27/h6-13,16H,1-5,14H2,(H,28,30) |
| InChIKey | DMIJOGMHIDXSBI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |