C19H18BrN3O2 — CID 146207311
N-[2-amino-1-(3-methoxyphenyl)ethyl]-6-bromoisoquinoline-3-carboxamide (PubChem CID 146207311) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is N-[2-amino-1-(3-methoxyphenyl)ethyl]-6-bromoisoquinoline-3-carboxamide.
| Compound Name | N-[2-amino-1-(3-methoxyphenyl)ethyl]-6-bromoisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 146207311 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[2-amino-1-(3-methoxyphenyl)ethyl]-6-bromoisoquinoline-3-carboxamide |
| SMILES | COc1cccc(C(CN)NC(=O)c2cc3cc(Br)ccc3cn2)c1 |
| InChI | InChI=1S/C19H18BrN3O2/c1-25-16-4-2-3-12(8-16)18(10-21)23-19(24)17-9-14-7-15(20)6-5-13(14)11-22-17/h2-9,11,18H,10,21H2,1H3,(H,23,24) |
| InChIKey | CPYZOKUXEAIQOQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |