C23H21FN4O2 — CID 146209142
N-[(1R)-2-amino-1-(3-methoxyphenyl)ethyl]-3-(3-fluoro-2H-indazol-5-yl)benzamide (PubChem CID 146209142) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is N-[(1R)-2-amino-1-(3-methoxyphenyl)ethyl]-3-(3-fluoro-2H-indazol-5-yl)benzamide.
| Compound Name | N-[(1R)-2-amino-1-(3-methoxyphenyl)ethyl]-3-(3-fluoro-2H-indazol-5-yl)benzamide |
|---|---|
| PubChem CID | 146209142 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[(1R)-2-amino-1-(3-methoxyphenyl)ethyl]-3-(3-fluoro-2H-indazol-5-yl)benzamide |
| SMILES | COc1cccc([C@H](CN)NC(=O)c2cccc(-c3ccc4n[nH]c(F)c4c3)c2)c1 |
| InChI | InChI=1S/C23H21FN4O2/c1-30-18-7-3-5-16(11-18)21(13-25)26-23(29)17-6-2-4-14(10-17)15-8-9-20-19(12-15)22(24)28-27-20/h2-12,21H,13,25H2,1H3,(H,26,29)(H,27,28)/t21-/m0/s1 |
| InChIKey | SBMZASWPEBFVCG-NRFANRHFSA-N |
| XLogP | 3.81 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |