C23H24N4O2 — CID 146209145
3-(4-amino-3-methanimidoylphenyl)-N-[2-amino-1-(3-methoxyphenyl)ethyl]benzamide (PubChem CID 146209145) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-(4-amino-3-methanimidoylphenyl)-N-[2-amino-1-(3-methoxyphenyl)ethyl]benzamide.
| Compound Name | 3-(4-amino-3-methanimidoylphenyl)-N-[2-amino-1-(3-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 146209145 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-(4-amino-3-methanimidoylphenyl)-N-[2-amino-1-(3-methoxyphenyl)ethyl]benzamide |
| SMILES | [H]/N=C/c1cc(-c2cccc(C(=O)NC(CN)c3cccc(OC)c3)c2)ccc1N |
| InChI | InChI=1S/C23H24N4O2/c1-29-20-7-3-5-17(12-20)22(14-25)27-23(28)18-6-2-4-15(10-18)16-8-9-21(26)19(11-16)13-24/h2-13,22,24H,14,25-26H2,1H3,(H,27,28)/b24-13+ |
| InChIKey | HXGOMBWPSVQGCY-ZMOGYAJESA-N |
| XLogP | 3.37 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|