C19H23N3O2 — CID 146207844
2-[(2R)-2,4-dimethylpentoxy]-5-(6-methoxypyrimidin-4-yl)benzonitrile (PubChem CID 146207844) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[(2R)-2,4-dimethylpentoxy]-5-(6-methoxypyrimidin-4-yl)benzonitrile.
| Compound Name | 2-[(2R)-2,4-dimethylpentoxy]-5-(6-methoxypyrimidin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 146207844 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[(2R)-2,4-dimethylpentoxy]-5-(6-methoxypyrimidin-4-yl)benzonitrile |
| SMILES | COc1cc(-c2ccc(OC[C@H](C)CC(C)C)c(C#N)c2)ncn1 |
| InChI | InChI=1S/C19H23N3O2/c1-13(2)7-14(3)11-24-18-6-5-15(8-16(18)10-20)17-9-19(23-4)22-12-21-17/h5-6,8-9,12-14H,7,11H2,1-4H3/t14-/m1/s1 |
| InChIKey | JXUXYQHOSDAALR-CQSZACIVSA-N |
| XLogP | 4.08 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |