C16H21ClN4O — CID 146208201
5-[[3-chloro-5-(6-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-4-methylpentan-2-amine (PubChem CID 146208201) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 5-[[3-chloro-5-(6-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-4-methylpentan-2-amine.
| Compound Name | 5-[[3-chloro-5-(6-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 146208201 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5-[[3-chloro-5-(6-methylpyrimidin-4-yl)-2-pyridinyl]oxy]-4-methylpentan-2-amine |
| SMILES | Cc1cc(-c2cnc(OCC(C)CC(C)N)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C16H21ClN4O/c1-10(4-11(2)18)8-22-16-14(17)6-13(7-19-16)15-5-12(3)20-9-21-15/h5-7,9-11H,4,8,18H2,1-3H3 |
| InChIKey | JYFCPOYBAVDTOG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |