C29H39FN4O5 — CID 146208925
(2S)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]-2-[[3-(2-methoxyethoxy)benzoyl]amino]butanoic acid (PubChem CID 146208925) has the molecular formula C29H39FN4O5 and a molecular weight of 542.65 g/mol. Its IUPAC name is (2S)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]-2-[[3-(2-methoxyethoxy)benzoyl]amino]butanoic acid.
| Compound Name | (2S)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]-2-[[3-(2-methoxyethoxy)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 146208925 |
| Molecular Formula | C29H39FN4O5 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (2S)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]piperidin-1-yl]-2-[[3-(2-methoxyethoxy)benzoyl]amino]butanoic acid |
| SMILES | COCCOc1cccc(C(=O)N[C@@H](CCN2CCC[C@@](F)(CCc3ccc4c(n3)NCCC4)C2)C(=O)O)c1 |
| InChI | InChI=1S/C29H39FN4O5/c1-38-17-18-39-24-7-2-5-22(19-24)27(35)33-25(28(36)37)11-16-34-15-4-12-29(30,20-34)13-10-23-9-8-21-6-3-14-31-26(21)32-23/h2,5,7-9,19,25H,3-4,6,10-18,20H2,1H3,(H,31,32)(H,33,35)(H,36,37)/t25-,29+/m0/s1 |
| InChIKey | QKCVLINUINOYEY-ABYGYWHVSA-N |
| XLogP | 3.47 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|